C36H60B2N2O2 — CID 102011545
1,3-ditert-butyl-2,4-bis(2,6-ditert-butylphenoxy)-1,3,2,4-diazadiboretidine (PubChem CID 102011545) has the molecular formula C36H60B2N2O2 and a molecular weight of 574.51 g/mol. Its IUPAC name is 1,3-ditert-butyl-2,4-bis(2,6-ditert-butylphenoxy)-1,3,2,4-diazadiboretidine.
| Compound Name | 1,3-ditert-butyl-2,4-bis(2,6-ditert-butylphenoxy)-1,3,2,4-diazadiboretidine |
|---|---|
| PubChem CID | 102011545 |
| Molecular Formula | C36H60B2N2O2 |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 574.48 |
| IUPAC Name | 1,3-ditert-butyl-2,4-bis(2,6-ditert-butylphenoxy)-1,3,2,4-diazadiboretidine |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1OB1N(C(C)(C)C)B(Oc2c(C(C)(C)C)cccc2C(C)(C)C)N1C(C)(C)C |
| InChI | InChI=1S/C36H60B2N2O2/c1-31(2,3)25-21-19-22-26(32(4,5)6)29(25)41-37-39(35(13,14)15)38(40(37)36(16,17)18)42-30-27(33(7,8)9)23-20-24-28(30)34(10,11)12/h19-24H,1-18H3 |
| InChIKey | SUFGZCMYDVQHAN-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|