C32H18O6 — CID 102012606
6,19-dioxadecacyclo[25.5.2.02,10.04,8.011,31.014,30.015,23.017,21.024,29.028,32]tetratriaconta-1,10,12,14,23,25,27,29,31,33-decaene-5,7,18,20-tetrone (PubChem CID 102012606) has the molecular formula C32H18O6 and a molecular weight of 498.49 g/mol. Its IUPAC name is 6,19-dioxadecacyclo[25.5.2.02,10.04,8.011,31.014,30.015,23.017,21.024,29.028,32]tetratriaconta-1,10,12,14,23,25,27,29,31,33-decaene-5,7,18,20-tetrone.
| Compound Name | 6,19-dioxadecacyclo[25.5.2.02,10.04,8.011,31.014,30.015,23.017,21.024,29.028,32]tetratriaconta-1,10,12,14,23,25,27,29,31,33-decaene-5,7,18,20-tetrone |
|---|---|
| PubChem CID | 102012606 |
| Molecular Formula | C32H18O6 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 6,19-dioxadecacyclo[25.5.2.02,10.04,8.011,31.014,30.015,23.017,21.024,29.028,32]tetratriaconta-1,10,12,14,23,25,27,29,31,33-decaene-5,7,18,20-tetrone |
| SMILES | O=C1OC(=O)C2Cc3c(c4ccc5ccc6c7c(c8ccc3c3c4c5c6c83)CC3C(=O)OC(=O)C3C7)CC12 |
| InChI | InChI=1S/C32H18O6/c33-29-20-7-16-12-3-1-11-2-4-13-17-8-21-23(32(36)38-30(21)34)10-19(17)15-6-5-14(18(16)9-22(20)31(35)37-29)27-25(12)24(11)26(13)28(15)27/h1-6,20-23H,7-10H2 |
| InChIKey | DLYUDUZLUUYJDW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|