C22H32O4 — CID 102012690
[(1R,2R,5R,10R,12R)-1-hydroxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-8,13-dien-13-yl]methyl acetate (PubChem CID 102012690) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(1R,2R,5R,10R,12R)-1-hydroxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-8,13-dien-13-yl]methyl acetate.
| Compound Name | [(1R,2R,5R,10R,12R)-1-hydroxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-8,13-dien-13-yl]methyl acetate |
|---|---|
| PubChem CID | 102012690 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1R,2R,5R,10R,12R)-1-hydroxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-8,13-dien-13-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@@]2(O)O[C@@H]1C[C@@H]1C3=C(C(C)C)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C22H32O4/c1-13(2)16-6-7-20(4)8-9-21(5)17(19(16)20)10-18-15(12-25-14(3)23)11-22(21,24)26-18/h11,13,17-18,24H,6-10,12H2,1-5H3/t17-,18-,20-,21-,22-/m1/s1 |
| InChIKey | WOKVOSAADLEXDD-ISMARYCFSA-N |
| XLogP | 4.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|