About 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide
2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 10201295) has the molecular formula C22H19N3O3S
and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide |
| PubChem CID | 10201295 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1ccc(Sc2ccc(-c3nc4ccc(C(N)=O)cc4[nH]3)cc2)cc1OC |
| InChI | InChI=1S/C22H19N3O3S/c1-27-19-10-8-16(12-20(19)28-2)29-15-6-3-13(4-7-15)22-24-17-9-5-14(21(23)26)11-18(17)25-22/h3-12H,1-2H3,(H2,23,26)(H,24,25) |
| InChIKey | KQFWAHJPCZAWRR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide?
The IUPAC name of 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide (CID 10201295) is 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide.
What is the SMILES notation for 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide?
The canonical SMILES for 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide is COc1ccc(Sc2ccc(-c3nc4ccc(C(N)=O)cc4[nH]3)cc2)cc1OC.
What is the InChIKey of 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide?
The InChIKey is KQFWAHJPCZAWRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O3S/c1-27-19-10-8-16(12-20(19)28-2)29-15-6-3-13(4-7-15)22-24-17-9-5-14(21(23)26)11-18(17)25-22/h3-12H,1-2H3,(H2,23,26)(H,24,25).
What are the key properties of 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide?
2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide has a molecular weight of 405.48 g/mol, XLogP of 4.50, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dimethoxyphenyl)sulfanylphenyl]-3H-benzimidazole-5-carboxamide is sourced from PubChem (CID 10201295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).