C35H38N2O2 — CID 102013043
3-(3,5-dimethylphenyl)-6-[2-[3-(3,5-dimethylphenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 102013043) has the molecular formula C35H38N2O2 and a molecular weight of 518.70 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-6-[2-[3-(3,5-dimethylphenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-(3,5-dimethylphenyl)-6-[2-[3-(3,5-dimethylphenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 102013043 |
| Molecular Formula | C35H38N2O2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-6-[2-[3-(3,5-dimethylphenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | Cc1cc(C)cc(N2COc3ccc(C(C)(C)c4ccc5c(c4)CN(c4cc(C)cc(C)c4)CO5)cc3C2)c1 |
| InChI | InChI=1S/C35H38N2O2/c1-23-11-24(2)14-31(13-23)36-19-27-17-29(7-9-33(27)38-21-36)35(5,6)30-8-10-34-28(18-30)20-37(22-39-34)32-15-25(3)12-26(4)16-32/h7-18H,19-22H2,1-6H3 |
| InChIKey | FOJMOEMVASXXMT-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |