C11H16O2 — CID 102013660
2-[(1S,2S,3R,4R)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane (PubChem CID 102013660) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[(1S,2S,3R,4R)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane.
| Compound Name | 2-[(1S,2S,3R,4R)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 102013660 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-[(1S,2S,3R,4R)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dioxolane |
| SMILES | C[C@H]1[C@H](C2OCCO2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C11H16O2/c1-7-8-2-3-9(6-8)10(7)11-12-4-5-13-11/h2-3,7-11H,4-6H2,1H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | ZPPKRYFKFQLUIW-RGOKHQFPSA-N |
| XLogP | 1.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|