About (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone
(2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone (PubChem CID 102013919) has the molecular formula C11H10N4O2S
and a molecular weight of 262.29 g/mol. Its IUPAC name is (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone.
Molecular Properties
| Compound Name | (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone |
| PubChem CID | 102013919 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone |
| SMILES | [N-]=[N+]=Nc1ccccc1C(=O)N1CC=CCS1=O |
| InChI | InChI=1S/C11H10N4O2S/c12-14-13-10-6-2-1-5-9(10)11(16)15-7-3-4-8-18(15)17/h1-6H,7-8H2 |
| InChIKey | RYYPDGLWIDVLBS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone?
The IUPAC name of (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone (CID 102013919) is (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone.
What is the SMILES notation for (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone?
The canonical SMILES for (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone is [N-]=[N+]=Nc1ccccc1C(=O)N1CC=CCS1=O.
What is the InChIKey of (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone?
The InChIKey is RYYPDGLWIDVLBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2S/c12-14-13-10-6-2-1-5-9(10)11(16)15-7-3-4-8-18(15)17/h1-6H,7-8H2.
What are the key properties of (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone?
(2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone has a molecular weight of 262.29 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-azidophenyl)-(1-oxo-3,6-dihydrothiazin-2-yl)methanone is sourced from PubChem (CID 102013919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).