C28H46N2O2 — CID 102014074
N-[(1S)-1-[(6S,11R,12S,14R,15S,16R)-6-(dimethylamino)-14-hydroxy-7,7,12,16-tetramethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]ethyl]acetamide (PubChem CID 102014074) has the molecular formula C28H46N2O2 and a molecular weight of 442.69 g/mol. Its IUPAC name is N-[(1S)-1-[(6S,11R,12S,14R,15S,16R)-6-(dimethylamino)-14-hydroxy-7,7,12,16-tetramethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]ethyl]acetamide.
| Compound Name | N-[(1S)-1-[(6S,11R,12S,14R,15S,16R)-6-(dimethylamino)-14-hydroxy-7,7,12,16-tetramethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]ethyl]acetamide |
|---|---|
| PubChem CID | 102014074 |
| Molecular Formula | C28H46N2O2 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | N-[(1S)-1-[(6S,11R,12S,14R,15S,16R)-6-(dimethylamino)-14-hydroxy-7,7,12,16-tetramethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](C)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CCC4C(=CC3=CC[C@]12C)CC[C@H](N(C)C)C4(C)C |
| InChI | InChI=1S/C28H46N2O2/c1-17(29-18(2)31)25-23(32)16-28(6)22-11-10-21-19(15-20(22)13-14-27(25,28)5)9-12-24(30(7)8)26(21,3)4/h13,15,17,21-25,32H,9-12,14,16H2,1-8H3,(H,29,31)/t17-,21?,22+,23+,24-,25-,27+,28-/m0/s1 |
| InChIKey | VOLYVWNBHURWEK-CIHPJLBSSA-N |
| XLogP | 4.94 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |