C19H25NO5 — CID 102014088
(2R)-2-[(1R,4S,5R,6S)-7-methyl-5-prop-2-enoxy-3,8-dioxa-7-azabicyclo[4.2.1]nonan-4-yl]-2-phenylmethoxyacetaldehyde (PubChem CID 102014088) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (2R)-2-[(1R,4S,5R,6S)-7-methyl-5-prop-2-enoxy-3,8-dioxa-7-azabicyclo[4.2.1]nonan-4-yl]-2-phenylmethoxyacetaldehyde.
| Compound Name | (2R)-2-[(1R,4S,5R,6S)-7-methyl-5-prop-2-enoxy-3,8-dioxa-7-azabicyclo[4.2.1]nonan-4-yl]-2-phenylmethoxyacetaldehyde |
|---|---|
| PubChem CID | 102014088 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2R)-2-[(1R,4S,5R,6S)-7-methyl-5-prop-2-enoxy-3,8-dioxa-7-azabicyclo[4.2.1]nonan-4-yl]-2-phenylmethoxyacetaldehyde |
| SMILES | C=CCO[C@H]1[C@@H]([C@H](C=O)OCc2ccccc2)OC[C@H]2C[C@@H]1N(C)O2 |
| InChI | InChI=1S/C19H25NO5/c1-3-9-22-18-16-10-15(25-20(16)2)13-24-19(18)17(11-21)23-12-14-7-5-4-6-8-14/h3-8,11,15-19H,1,9-10,12-13H2,2H3/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | CYCMCKSXEDHKAX-ICBNADEASA-N |
| XLogP | 1.75 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|