About 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one
2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one (PubChem CID 10201429) has the molecular formula C23H19F2N3O2
and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one.
Molecular Properties
| Compound Name | 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one |
| PubChem CID | 10201429 |
| Molecular Formula | C23H19F2N3O2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one |
| SMILES | Cc1cc2c(c(OCC(F)F)n1)c(=O)cc(Nc1ccccc1)n2-c1ccccc1 |
| InChI | InChI=1S/C23H19F2N3O2/c1-15-12-18-22(23(26-15)30-14-20(24)25)19(29)13-21(27-16-8-4-2-5-9-16)28(18)17-10-6-3-7-11-17/h2-13,20,27H,14H2,1H3 |
| InChIKey | SLPKEEQAUGMTCT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one?
The IUPAC name of 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one (CID 10201429) is 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one.
What is the SMILES notation for 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one?
The canonical SMILES for 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one is Cc1cc2c(c(OCC(F)F)n1)c(=O)cc(Nc1ccccc1)n2-c1ccccc1.
What is the InChIKey of 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one?
The InChIKey is SLPKEEQAUGMTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F2N3O2/c1-15-12-18-22(23(26-15)30-14-20(24)25)19(29)13-21(27-16-8-4-2-5-9-16)28(18)17-10-6-3-7-11-17/h2-13,20,27H,14H2,1H3.
What are the key properties of 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one?
2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one has a molecular weight of 407.42 g/mol, XLogP of 5.08, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-5-(2,2-difluoroethoxy)-7-methyl-1-phenyl-1,6-naphthyridin-4-one is sourced from PubChem (CID 10201429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).