C19H19NO3 — CID 102015011
[(2R,3S)-1-benzyl-4-oxo-3-phenylazetidin-2-yl]methyl acetate (PubChem CID 102015011) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is [(2R,3S)-1-benzyl-4-oxo-3-phenylazetidin-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-1-benzyl-4-oxo-3-phenylazetidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102015011 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | [(2R,3S)-1-benzyl-4-oxo-3-phenylazetidin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@H](c2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-14(21)23-13-17-18(16-10-6-3-7-11-16)19(22)20(17)12-15-8-4-2-5-9-15/h2-11,17-18H,12-13H2,1H3/t17-,18-/m0/s1 |
| InChIKey | YEJHBUKJBIMOBP-ROUUACIJSA-N |
| XLogP | 2.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |