C41H56N4O8 — CID 102016323
ditert-butyl 4-[4-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]butanoylamino]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate (PubChem CID 102016323) has the molecular formula C41H56N4O8 and a molecular weight of 732.92 g/mol. Its IUPAC name is ditert-butyl 4-[4-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]butanoylamino]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate.
| Compound Name | ditert-butyl 4-[4-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]butanoylamino]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate |
|---|---|
| PubChem CID | 102016323 |
| Molecular Formula | C41H56N4O8 |
| Molecular Weight | 732.92 g/mol |
| Exact Mass | 732.41 |
| IUPAC Name | ditert-butyl 4-[4-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]butanoylamino]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]heptanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(CCC(=O)OC(C)(C)C)(CCC(=O)OC(C)(C)C)NC(=O)CCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C41H56N4O8/c1-38(2,3)51-35(47)18-21-41(22-19-36(48)52-39(4,5)6,23-20-37(49)53-40(7,8)9)45-34(46)17-14-26-50-29-27-32(30-15-10-12-24-42-30)44-33(28-29)31-16-11-13-25-43-31/h10-13,15-16,24-25,27-28H,14,17-23,26H2,1-9H3,(H,45,46) |
| InChIKey | RHOATYMJSGETLZ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.92 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|