C36H32N2O8S2 — CID 102016528
3,16-dioxa-9,10-dithia-6,13-diazahexacyclo[16.15.7.124,28.135,39.02,30.017,22]dotetraconta-1(33),2(30),17(22),18,20,24,27,31,35,38-decaene-5,14,26,37,41,42-hexone (PubChem CID 102016528) has the molecular formula C36H32N2O8S2 and a molecular weight of 684.79 g/mol. Its IUPAC name is 3,16-dioxa-9,10-dithia-6,13-diazahexacyclo[16.15.7.124,28.135,39.02,30.017,22]dotetraconta-1(33),2(30),17(22),18,20,24,27,31,35,38-decaene-5,14,26,37,41,42-hexone.
| Compound Name | 3,16-dioxa-9,10-dithia-6,13-diazahexacyclo[16.15.7.124,28.135,39.02,30.017,22]dotetraconta-1(33),2(30),17(22),18,20,24,27,31,35,38-decaene-5,14,26,37,41,42-hexone |
|---|---|
| PubChem CID | 102016528 |
| Molecular Formula | C36H32N2O8S2 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.16 |
| IUPAC Name | 3,16-dioxa-9,10-dithia-6,13-diazahexacyclo[16.15.7.124,28.135,39.02,30.017,22]dotetraconta-1(33),2(30),17(22),18,20,24,27,31,35,38-decaene-5,14,26,37,41,42-hexone |
| SMILES | O=C1C=C2Cc3cccc4c3OCC(=O)NCCSSCCNC(=O)COc3c(cccc3CC3=CC(=O)C=C(C4)C3=O)CC(=C1)C2=O |
| InChI | InChI=1S/C36H32N2O8S2/c39-29-15-25-11-21-3-1-4-22-12-26-16-30(40)18-28(34(26)44)14-24-6-2-5-23(13-27(17-29)33(25)43)36(24)46-20-32(42)38-8-10-48-47-9-7-37-31(41)19-45-35(21)22/h1-6,15-18H,7-14,19-20H2,(H,37,41)(H,38,42) |
| InChIKey | KRPBAFJQPCPJTD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|