C27H54O5Si — CID 102016755
tert-butyl-[(Z)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-12-(2-ethoxyethoxy)dodec-1-en-4-yl]oxy-dimethylsilane (PubChem CID 102016755) has the molecular formula C27H54O5Si and a molecular weight of 486.81 g/mol. Its IUPAC name is tert-butyl-[(Z)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-12-(2-ethoxyethoxy)dodec-1-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-12-(2-ethoxyethoxy)dodec-1-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102016755 |
| Molecular Formula | C27H54O5Si |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | tert-butyl-[(Z)-1-(2,2-dimethyl-1,3-dioxolan-4-yl)-12-(2-ethoxyethoxy)dodec-1-en-4-yl]oxy-dimethylsilane |
| SMILES | CCOCCOCCCCCCCCC(C/C=C\C1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O5Si/c1-9-28-21-22-29-20-15-13-11-10-12-14-17-24(32-33(7,8)26(2,3)4)18-16-19-25-23-30-27(5,6)31-25/h16,19,24-25H,9-15,17-18,20-23H2,1-8H3/b19-16- |
| InChIKey | ZDEXWMYZMJSIGU-MNDPQUGUSA-N |
| XLogP | 7.26 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|