C25H49IO5Si — CID 102016997
[(E,3S,4R,5S,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-3,7-dimethoxy-4,8-dimethyldec-9-enyl] 2,2-dimethylpropanoate (PubChem CID 102016997) has the molecular formula C25H49IO5Si and a molecular weight of 584.65 g/mol. Its IUPAC name is [(E,3S,4R,5S,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-3,7-dimethoxy-4,8-dimethyldec-9-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,3S,4R,5S,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-3,7-dimethoxy-4,8-dimethyldec-9-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102016997 |
| Molecular Formula | C25H49IO5Si |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | [(E,3S,4R,5S,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-3,7-dimethoxy-4,8-dimethyldec-9-enyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H](CCOC(=O)C(C)(C)C)[C@@H](C)[C@H](C[C@H](OC)[C@@H](C)/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H49IO5Si/c1-18(13-15-26)21(29-10)17-22(31-32(11,12)25(6,7)8)19(2)20(28-9)14-16-30-23(27)24(3,4)5/h13,15,18-22H,14,16-17H2,1-12H3/b15-13+/t18-,19+,20-,21-,22-/m0/s1 |
| InChIKey | IVIMATFMPPBDJX-RUUQTXTCSA-N |
| XLogP | 7.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|