C20H28B2N4 — CID 102017245
2-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)-1,3-diethyl-1,3,2-benzodiazaborole (PubChem CID 102017245) has the molecular formula C20H28B2N4 and a molecular weight of 346.10 g/mol. Its IUPAC name is 2-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)-1,3-diethyl-1,3,2-benzodiazaborole.
| Compound Name | 2-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)-1,3-diethyl-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 102017245 |
| Molecular Formula | C20H28B2N4 |
| Molecular Weight | 346.10 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-(1,3-diethyl-1,3,2-benzodiazaborol-2-yl)-1,3-diethyl-1,3,2-benzodiazaborole |
| SMILES | CCN1B(B2N(CC)c3ccccc3N2CC)N(CC)c2ccccc21 |
| InChI | InChI=1S/C20H28B2N4/c1-5-23-17-13-9-10-14-18(17)24(6-2)21(23)22-25(7-3)19-15-11-12-16-20(19)26(22)8-4/h9-16H,5-8H2,1-4H3 |
| InChIKey | RMYXURFPNKUUHX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.10 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|