C25H34ClNO3SSi — CID 102018346
(2S,3R,4R)-3-[benzhydryl(dimethyl)silyl]-2-(2,2-dimethylpropyl)-4-methyl-5-oxopyrrolidine-1-sulfonyl chloride (PubChem CID 102018346) has the molecular formula C25H34ClNO3SSi and a molecular weight of 492.16 g/mol. Its IUPAC name is (2S,3R,4R)-3-[benzhydryl(dimethyl)silyl]-2-(2,2-dimethylpropyl)-4-methyl-5-oxopyrrolidine-1-sulfonyl chloride.
| Compound Name | (2S,3R,4R)-3-[benzhydryl(dimethyl)silyl]-2-(2,2-dimethylpropyl)-4-methyl-5-oxopyrrolidine-1-sulfonyl chloride |
|---|---|
| PubChem CID | 102018346 |
| Molecular Formula | C25H34ClNO3SSi |
| Molecular Weight | 492.16 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (2S,3R,4R)-3-[benzhydryl(dimethyl)silyl]-2-(2,2-dimethylpropyl)-4-methyl-5-oxopyrrolidine-1-sulfonyl chloride |
| SMILES | C[C@@H]1C(=O)N(S(=O)(=O)Cl)[C@@H](CC(C)(C)C)[C@@H]1[Si](C)(C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34ClNO3SSi/c1-18-22(21(17-25(2,3)4)27(24(18)28)31(26,29)30)32(5,6)23(19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21-23H,17H2,1-6H3/t18-,21-,22+/m0/s1 |
| InChIKey | XNKAPHQXEGITAU-YUXAGFNASA-N |
| XLogP | 6.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.16 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|