C27H28O3 — CID 102018464
[(1S)-1-[(1S,2S)-2-hydroxy-1-phenylcyclohexyl]-2-phenylethyl] benzoate (PubChem CID 102018464) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(1S)-1-[(1S,2S)-2-hydroxy-1-phenylcyclohexyl]-2-phenylethyl] benzoate.
| Compound Name | [(1S)-1-[(1S,2S)-2-hydroxy-1-phenylcyclohexyl]-2-phenylethyl] benzoate |
|---|---|
| PubChem CID | 102018464 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [(1S)-1-[(1S,2S)-2-hydroxy-1-phenylcyclohexyl]-2-phenylethyl] benzoate |
| SMILES | O=C(O[C@@H](Cc1ccccc1)[C@]1(c2ccccc2)CCCC[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C27H28O3/c28-24-18-10-11-19-27(24,23-16-8-3-9-17-23)25(20-21-12-4-1-5-13-21)30-26(29)22-14-6-2-7-15-22/h1-9,12-17,24-25,28H,10-11,18-20H2/t24-,25-,27-/m0/s1 |
| InChIKey | DJRISANHXBBLIF-KLJDGLGGSA-N |
| XLogP | 5.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |