C17H24O3 — CID 102019078
(2S,6R,7Z)-4,4,13,14,14-pentamethyl-3,5-dioxatricyclo[8.3.1.02,6]tetradeca-1(13),7-dien-9-one (PubChem CID 102019078) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2S,6R,7Z)-4,4,13,14,14-pentamethyl-3,5-dioxatricyclo[8.3.1.02,6]tetradeca-1(13),7-dien-9-one.
| Compound Name | (2S,6R,7Z)-4,4,13,14,14-pentamethyl-3,5-dioxatricyclo[8.3.1.02,6]tetradeca-1(13),7-dien-9-one |
|---|---|
| PubChem CID | 102019078 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2S,6R,7Z)-4,4,13,14,14-pentamethyl-3,5-dioxatricyclo[8.3.1.02,6]tetradeca-1(13),7-dien-9-one |
| SMILES | CC1=C2[C@@H]3OC(C)(C)O[C@@H]3/C=C\C(=O)C(CC1)C2(C)C |
| InChI | InChI=1S/C17H24O3/c1-10-6-7-11-12(18)8-9-13-15(14(10)16(11,2)3)20-17(4,5)19-13/h8-9,11,13,15H,6-7H2,1-5H3/b9-8-/t11?,13-,15-/m1/s1 |
| InChIKey | QLTBZBDAVUKZQR-MEPYSUMNSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|