C17H28O2Si — CID 102020096
3,3,5-trimethyl-7-[(E)-1-trimethylsilyloxyprop-1-enyl]bicyclo[2.2.2]oct-5-en-2-one (PubChem CID 102020096) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is 3,3,5-trimethyl-7-[(E)-1-trimethylsilyloxyprop-1-enyl]bicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | 3,3,5-trimethyl-7-[(E)-1-trimethylsilyloxyprop-1-enyl]bicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 102020096 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3,3,5-trimethyl-7-[(E)-1-trimethylsilyloxyprop-1-enyl]bicyclo[2.2.2]oct-5-en-2-one |
| SMILES | C/C=C(/O[Si](C)(C)C)C1CC2C(C)=CC1C(=O)C2(C)C |
| InChI | InChI=1S/C17H28O2Si/c1-8-15(19-20(5,6)7)12-10-14-11(2)9-13(12)16(18)17(14,3)4/h8-9,12-14H,10H2,1-7H3/b15-8+ |
| InChIKey | NYSGMCZRGAJPJB-OVCLIPMQSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|