About 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol
2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol (PubChem CID 102020240) has the molecular formula C25H29NO3
and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol.
Molecular Properties
| Compound Name | 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol |
| PubChem CID | 102020240 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol |
| SMILES | COc1ccc(N(Cc2cc(C)cc(C)c2O)Cc2cc(C)cc(C)c2O)cc1 |
| InChI | InChI=1S/C25H29NO3/c1-16-10-18(3)24(27)20(12-16)14-26(22-6-8-23(29-5)9-7-22)15-21-13-17(2)11-19(4)25(21)28/h6-13,27-28H,14-15H2,1-5H3 |
| InChIKey | BQLIDSYDMIXCOP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol?
The IUPAC name of 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol (CID 102020240) is 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol.
What is the SMILES notation for 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol?
The canonical SMILES for 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol is COc1ccc(N(Cc2cc(C)cc(C)c2O)Cc2cc(C)cc(C)c2O)cc1.
What is the InChIKey of 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol?
The InChIKey is BQLIDSYDMIXCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO3/c1-16-10-18(3)24(27)20(12-16)14-26(22-6-8-23(29-5)9-7-22)15-21-13-17(2)11-19(4)25(21)28/h6-13,27-28H,14-15H2,1-5H3.
What are the key properties of 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol?
2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol has a molecular weight of 391.51 g/mol, XLogP of 5.55, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[N-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4-methoxyanilino]methyl]-4,6-dimethylphenol is sourced from PubChem (CID 102020240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).