C17H16ClNO3 — CID 102020553
methyl N-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]carbamate (PubChem CID 102020553) has the molecular formula C17H16ClNO3 and a molecular weight of 317.77 g/mol. Its IUPAC name is methyl N-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]carbamate.
| Compound Name | methyl N-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 102020553 |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | methyl N-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl]carbamate |
| SMILES | COC(=O)NC(CC(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO3/c1-22-17(21)19-15(12-7-9-14(18)10-8-12)11-16(20)13-5-3-2-4-6-13/h2-10,15H,11H2,1H3,(H,19,21) |
| InChIKey | CIXGGSSNSXFCID-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |