C24H28N4O5 — CID 102020703
5-[4-(4-hydroxybutyl)piperazin-1-yl]-5-(4-phenoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 102020703) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 5-[4-(4-hydroxybutyl)piperazin-1-yl]-5-(4-phenoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[4-(4-hydroxybutyl)piperazin-1-yl]-5-(4-phenoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 102020703 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-[4-(4-hydroxybutyl)piperazin-1-yl]-5-(4-phenoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(c2ccc(Oc3ccccc3)cc2)(N2CCN(CCCCO)CC2)C(=O)N1 |
| InChI | InChI=1S/C24H28N4O5/c29-17-5-4-12-27-13-15-28(16-14-27)24(21(30)25-23(32)26-22(24)31)18-8-10-20(11-9-18)33-19-6-2-1-3-7-19/h1-3,6-11,29H,4-5,12-17H2,(H2,25,26,30,31,32) |
| InChIKey | BCRURWKEIBMTRR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|