C8H8O7 — CID 102020809
(3S,4S)-3,4-diacetyl-3,4-dihydroxyoxolane-2,5-dione (PubChem CID 102020809) has the molecular formula C8H8O7 and a molecular weight of 216.14 g/mol. Its IUPAC name is (3S,4S)-3,4-diacetyl-3,4-dihydroxyoxolane-2,5-dione.
| Compound Name | (3S,4S)-3,4-diacetyl-3,4-dihydroxyoxolane-2,5-dione |
|---|---|
| PubChem CID | 102020809 |
| Molecular Formula | C8H8O7 |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | (3S,4S)-3,4-diacetyl-3,4-dihydroxyoxolane-2,5-dione |
| SMILES | CC(=O)[C@]1(O)C(=O)OC(=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C8H8O7/c1-3(9)7(13)5(11)15-6(12)8(7,14)4(2)10/h13-14H,1-2H3/t7-,8-/m0/s1 |
| InChIKey | KGCYYMUHGZTDQN-YUMQZZPRSA-N |
| XLogP | -2.29 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|