C21H36O5 — CID 102020974
(E,7S)-7-[(4R,5S)-5-(methoxymethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]tridec-5-en-8-yn-7-ol (PubChem CID 102020974) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is (E,7S)-7-[(4R,5S)-5-(methoxymethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]tridec-5-en-8-yn-7-ol.
| Compound Name | (E,7S)-7-[(4R,5S)-5-(methoxymethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]tridec-5-en-8-yn-7-ol |
|---|---|
| PubChem CID | 102020974 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (E,7S)-7-[(4R,5S)-5-(methoxymethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]tridec-5-en-8-yn-7-ol |
| SMILES | CCCCC#C[C@@](O)(/C=C/CCCC)[C@@H]1OC(C)(C)O[C@H]1COCOC |
| InChI | InChI=1S/C21H36O5/c1-6-8-10-12-14-21(22,15-13-11-9-7-2)19-18(16-24-17-23-5)25-20(3,4)26-19/h12,14,18-19,22H,6-11,16-17H2,1-5H3/b14-12+/t18-,19+,21-/m0/s1 |
| InChIKey | OCPUVSDFTOVVQS-LNYVVFMMSA-N |
| XLogP | 3.80 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|