C31H52O2 — CID 102021806
(3S,4aR,6aS,6bS,8aS,11R,12aR,14bS)-11-[(1R)-1-hydroxyethyl]-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetradecahydropicen-3-ol (PubChem CID 102021806) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is (3S,4aR,6aS,6bS,8aS,11R,12aR,14bS)-11-[(1R)-1-hydroxyethyl]-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetradecahydropicen-3-ol.
| Compound Name | (3S,4aR,6aS,6bS,8aS,11R,12aR,14bS)-11-[(1R)-1-hydroxyethyl]-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetradecahydropicen-3-ol |
|---|---|
| PubChem CID | 102021806 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | (3S,4aR,6aS,6bS,8aS,11R,12aR,14bS)-11-[(1R)-1-hydroxyethyl]-4,4,6a,6b,8a,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetradecahydropicen-3-ol |
| SMILES | C[C@@H](O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=C(CC[C@@]3(C)[C@@H]2C1)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC4 |
| InChI | InChI=1S/C31H52O2/c1-20(32)28(5)16-15-27(4)17-18-30(7)22-9-10-23-26(2,3)25(33)12-13-29(23,6)21(22)11-14-31(30,8)24(27)19-28/h20,23-25,32-33H,9-19H2,1-8H3/t20-,23+,24-,25+,27-,28-,29-,30-,31+/m1/s1 |
| InChIKey | SBFZUTXJWNRNLJ-QHVULHOESA-N |
| XLogP | 7.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|