C29H46O4Si — CID 102021889
methyl (4R,4aS,14aS)-14a-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-4,4a,5,6,7,8,9,10,11,12,13,14-dodecahydrocyclododeca[b]pyran-2-carboxylate (PubChem CID 102021889) has the molecular formula C29H46O4Si and a molecular weight of 486.77 g/mol. Its IUPAC name is methyl (4R,4aS,14aS)-14a-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-4,4a,5,6,7,8,9,10,11,12,13,14-dodecahydrocyclododeca[b]pyran-2-carboxylate.
| Compound Name | methyl (4R,4aS,14aS)-14a-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-4,4a,5,6,7,8,9,10,11,12,13,14-dodecahydrocyclododeca[b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 102021889 |
| Molecular Formula | C29H46O4Si |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | methyl (4R,4aS,14aS)-14a-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-4,4a,5,6,7,8,9,10,11,12,13,14-dodecahydrocyclododeca[b]pyran-2-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](c2ccccc2)[C@@H]2CCCCCCCCCC[C@@]2(O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H46O4Si/c1-28(2,3)34(5,6)33-29-21-17-12-10-8-7-9-11-16-20-25(29)24(23-18-14-13-15-19-23)22-26(32-29)27(30)31-4/h13-15,18-19,22,24-25H,7-12,16-17,20-21H2,1-6H3/t24-,25-,29-/m0/s1 |
| InChIKey | JHESTSSJBKXHIN-QEMZJVQQSA-N |
| XLogP | 8.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|