C19H16ClFN2O — CID 102022295
(3aS,4R,9bS)-6-chloro-4-(6-fluoro-1H-indol-3-yl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 102022295) has the molecular formula C19H16ClFN2O and a molecular weight of 342.80 g/mol. Its IUPAC name is (3aS,4R,9bS)-6-chloro-4-(6-fluoro-1H-indol-3-yl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | (3aS,4R,9bS)-6-chloro-4-(6-fluoro-1H-indol-3-yl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 102022295 |
| Molecular Formula | C19H16ClFN2O |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (3aS,4R,9bS)-6-chloro-4-(6-fluoro-1H-indol-3-yl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | Fc1ccc2c([C@@H]3Nc4c(Cl)cccc4[C@H]4OCC[C@H]43)c[nH]c2c1 |
| InChI | InChI=1S/C19H16ClFN2O/c20-15-3-1-2-12-18(15)23-17(13-6-7-24-19(12)13)14-9-22-16-8-10(21)4-5-11(14)16/h1-5,8-9,13,17,19,22-23H,6-7H2/t13-,17+,19+/m0/s1 |
| InChIKey | WSXOSDQIEQIYAA-BOFPYLFWSA-N |
| XLogP | 5.20 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |