C17H28NO3PS — CID 102022357
(2S,4S)-4-di(propan-2-yloxy)phosphoryl-5,5-dimethyl-2-phenyl-1,3-thiazolidine (PubChem CID 102022357) has the molecular formula C17H28NO3PS and a molecular weight of 357.46 g/mol. Its IUPAC name is (2S,4S)-4-di(propan-2-yloxy)phosphoryl-5,5-dimethyl-2-phenyl-1,3-thiazolidine.
| Compound Name | (2S,4S)-4-di(propan-2-yloxy)phosphoryl-5,5-dimethyl-2-phenyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 102022357 |
| Molecular Formula | C17H28NO3PS |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2S,4S)-4-di(propan-2-yloxy)phosphoryl-5,5-dimethyl-2-phenyl-1,3-thiazolidine |
| SMILES | CC(C)OP(=O)(OC(C)C)[C@@H]1N[C@H](c2ccccc2)SC1(C)C |
| InChI | InChI=1S/C17H28NO3PS/c1-12(2)20-22(19,21-13(3)4)16-17(5,6)23-15(18-16)14-10-8-7-9-11-14/h7-13,15-16,18H,1-6H3/t15-,16-/m0/s1 |
| InChIKey | QWENSENOMISTDS-HOTGVXAUSA-N |
| XLogP | 5.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|