C21H32O6 — CID 102022432
methyl (1'S,5'S,6'R)-5'-(2-acetyloxyethyl)-1',5',6'-trimethylspiro[1,3-dioxolane-2,3'-4,6,7,8-tetrahydro-2H-naphthalene]-1'-carboxylate (PubChem CID 102022432) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is methyl (1'S,5'S,6'R)-5'-(2-acetyloxyethyl)-1',5',6'-trimethylspiro[1,3-dioxolane-2,3'-4,6,7,8-tetrahydro-2H-naphthalene]-1'-carboxylate.
| Compound Name | methyl (1'S,5'S,6'R)-5'-(2-acetyloxyethyl)-1',5',6'-trimethylspiro[1,3-dioxolane-2,3'-4,6,7,8-tetrahydro-2H-naphthalene]-1'-carboxylate |
|---|---|
| PubChem CID | 102022432 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | methyl (1'S,5'S,6'R)-5'-(2-acetyloxyethyl)-1',5',6'-trimethylspiro[1,3-dioxolane-2,3'-4,6,7,8-tetrahydro-2H-naphthalene]-1'-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC2(CC3=C1CC[C@@H](C)[C@]3(C)CCOC(C)=O)OCCO2 |
| InChI | InChI=1S/C21H32O6/c1-14-6-7-16-17(19(14,3)8-9-25-15(2)22)12-21(26-10-11-27-21)13-20(16,4)18(23)24-5/h14H,6-13H2,1-5H3/t14-,19+,20+/m1/s1 |
| InChIKey | CACMWXGAIMBNCL-UAOJZALGSA-N |
| XLogP | 3.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|