C18H28O2 — CID 102022515
(2S,4R,7R,9S)-2,5,9-trimethyl-4,7-bis(prop-2-enyl)tricyclo[4.3.0.01,5]nonane-4,7-diol (PubChem CID 102022515) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (2S,4R,7R,9S)-2,5,9-trimethyl-4,7-bis(prop-2-enyl)tricyclo[4.3.0.01,5]nonane-4,7-diol.
| Compound Name | (2S,4R,7R,9S)-2,5,9-trimethyl-4,7-bis(prop-2-enyl)tricyclo[4.3.0.01,5]nonane-4,7-diol |
|---|---|
| PubChem CID | 102022515 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (2S,4R,7R,9S)-2,5,9-trimethyl-4,7-bis(prop-2-enyl)tricyclo[4.3.0.01,5]nonane-4,7-diol |
| SMILES | C=CCC1(O)CC(C)C23C1C2(C)[C@@](O)(CC=C)C[C@@H]3C |
| InChI | InChI=1S/C18H28O2/c1-6-8-16(19)10-12(3)18-13(4)11-17(20,9-7-2)15(18,5)14(16)18/h6-7,12-14,19-20H,1-2,8-11H2,3-5H3/t12?,13-,14?,15?,16?,17+,18?/m0/s1 |
| InChIKey | SUYCHPNGTHTCCP-GICAVJAXSA-N |
| XLogP | 3.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|