C22H20N4O3S — CID 10202306
N-(2-aminophenyl)-4-[(1-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-3-yl)methyl]benzamide (PubChem CID 10202306) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(1-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-3-yl)methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(1-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 10202306 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-(2-aminophenyl)-4-[(1-ethyl-2,4-dioxothieno[3,2-d]pyrimidin-3-yl)methyl]benzamide |
| SMILES | CCn1c(=O)n(Cc2ccc(C(=O)Nc3ccccc3N)cc2)c(=O)c2sccc21 |
| InChI | InChI=1S/C22H20N4O3S/c1-2-25-18-11-12-30-19(18)21(28)26(22(25)29)13-14-7-9-15(10-8-14)20(27)24-17-6-4-3-5-16(17)23/h3-12H,2,13,23H2,1H3,(H,24,27) |
| InChIKey | JYNOJOKYKJNDRW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|