C27H32O4 — CID 10202323
(E)-3-[7-(3,5-Diisopropyl-2-propoxy-phenyl)-benzofuran-2-yl]-but-2-enoic acid (PubChem CID 10202323) has the molecular formula C27H32O4 and a molecular weight of 420.50 g/mol. Its IUPAC name is (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoic acid.
| Compound Name | (E)-3-[7-(3,5-Diisopropyl-2-propoxy-phenyl)-benzofuran-2-yl]-but-2-enoic acid |
|---|---|
| PubChem CID | 10202323 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (E)-3-[7-[3,5-di(propan-2-yl)-2-propoxyphenyl]-1-benzofuran-2-yl]but-2-enoic acid |
| SMILES | CCCOC1=C(C=C(C=C1C(C)C)C(C)C)C2=CC=CC3=C2OC(=C3)/C(=C/C(=O)O)/C |
| InChI | InChI=1S/C27H32O4/c1-7-11-30-27-22(17(4)5)13-20(16(2)3)14-23(27)21-10-8-9-19-15-24(31-26(19)21)18(6)12-25(28)29/h8-10,12-17H,7,11H2,1-6H3,(H,28,29)/b18-12+ |
| InChIKey | DPZKZYSYZRNUER-LDADJPATSA-N |
| XLogP | 7.70 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | 625 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|