About 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid
2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid (PubChem CID 10202327) has the molecular formula C20H20O4S3
and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid |
| PubChem CID | 10202327 |
| Molecular Formula | C20H20O4S3 |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid |
| SMILES | Cc1ccc2sc(-c3ccc(C4(CC(=O)O)CCCCS4(=O)=O)s3)cc2c1 |
| InChI | InChI=1S/C20H20O4S3/c1-13-4-5-15-14(10-13)11-17(25-15)16-6-7-18(26-16)20(12-19(21)22)8-2-3-9-27(20,23)24/h4-7,10-11H,2-3,8-9,12H2,1H3,(H,21,22) |
| InChIKey | WXZZLLZHMUXFKY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid?
The IUPAC name of 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid (CID 10202327) is 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid.
What is the SMILES notation for 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid?
The canonical SMILES for 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid is Cc1ccc2sc(-c3ccc(C4(CC(=O)O)CCCCS4(=O)=O)s3)cc2c1.
What is the InChIKey of 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid?
The InChIKey is WXZZLLZHMUXFKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O4S3/c1-13-4-5-15-14(10-13)11-17(25-15)16-6-7-18(26-16)20(12-19(21)22)8-2-3-9-27(20,23)24/h4-7,10-11H,2-3,8-9,12H2,1H3,(H,21,22).
What are the key properties of 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid?
2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid has a molecular weight of 420.58 g/mol, XLogP of 5.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[5-(5-methyl-1-benzothiophen-2-yl)thiophen-2-yl]-1,1-dioxothian-2-yl]acetic acid is sourced from PubChem (CID 10202327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).