C26H46O4Si — CID 102023854
(6R,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(2-methylpropan-2-yl)oxy]-6-trimethylsilyloxy-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3-diol (PubChem CID 102023854) has the molecular formula C26H46O4Si and a molecular weight of 450.74 g/mol. Its IUPAC name is (6R,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(2-methylpropan-2-yl)oxy]-6-trimethylsilyloxy-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3-diol.
| Compound Name | (6R,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(2-methylpropan-2-yl)oxy]-6-trimethylsilyloxy-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 102023854 |
| Molecular Formula | C26H46O4Si |
| Molecular Weight | 450.74 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | (6R,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-17-[(2-methylpropan-2-yl)oxy]-6-trimethylsilyloxy-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3-diol |
| SMILES | CC(C)(C)O[C@H]1CC[C@H]2[C@@H]3C[C@@H](O[Si](C)(C)C)C4=CC(O)C(O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H46O4Si/c1-24(2,3)29-23-10-9-17-16-13-22(30-31(6,7)8)19-14-20(27)21(28)15-26(19,5)18(16)11-12-25(17,23)4/h14,16-18,20-23,27-28H,9-13,15H2,1-8H3/t16-,17-,18-,20?,21?,22+,23-,25-,26+/m0/s1 |
| InChIKey | UKZOGDCBKCNUJR-XWDYLESDSA-N |
| XLogP | 5.29 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.74 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|