C17H19FN2O — CID 102024613
(15S,20S)-5-fluoro-17-oxa-1,11-diazapentacyclo[9.7.2.02,7.08,19.015,20]icosa-2(7),3,5,8(19)-tetraene (PubChem CID 102024613) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is (15S,20S)-5-fluoro-17-oxa-1,11-diazapentacyclo[9.7.2.02,7.08,19.015,20]icosa-2(7),3,5,8(19)-tetraene.
| Compound Name | (15S,20S)-5-fluoro-17-oxa-1,11-diazapentacyclo[9.7.2.02,7.08,19.015,20]icosa-2(7),3,5,8(19)-tetraene |
|---|---|
| PubChem CID | 102024613 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (15S,20S)-5-fluoro-17-oxa-1,11-diazapentacyclo[9.7.2.02,7.08,19.015,20]icosa-2(7),3,5,8(19)-tetraene |
| SMILES | Fc1ccc2c(c1)c1c3n2COC[C@H]2CCCN(CC1)[C@H]32 |
| InChI | InChI=1S/C17H19FN2O/c18-12-3-4-15-14(8-12)13-5-7-19-6-1-2-11-9-21-10-20(15)17(13)16(11)19/h3-4,8,11,16H,1-2,5-7,9-10H2/t11-,16+/m1/s1 |
| InChIKey | VNSRLMQLVYDTOH-BZNIZROVSA-N |
| XLogP | 3.08 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|