C9H15O8- — CID 102024645
(2S)-2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoate (PubChem CID 102024645) has the molecular formula C9H15O8- and a molecular weight of 251.21 g/mol. Its IUPAC name is (2S)-2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoate.
| Compound Name | (2S)-2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 102024645 |
| Molecular Formula | C9H15O8- |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (2S)-2-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanoate |
| SMILES | C[C@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O)C(=O)[O-] |
| InChI | InChI=1S/C9H16O8/c1-3(8(14)15)16-9-7(13)6(12)5(11)4(2-10)17-9/h3-7,9-13H,2H2,1H3,(H,14,15)/p-1/t3-,4+,5+,6-,7-,9-/m0/s1 |
| InChIKey | UHBAFOKDFZXQAZ-DHGOSONXSA-M |
| XLogP | -4.06 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |