C19H28O5 — CID 102025315
(1S,2R,5R,6R,8R)-2-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-5,11-dihydroxy-8-methyl-7,9-dioxatricyclo[6.2.1.01,6]undec-3-en-10-one (PubChem CID 102025315) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (1S,2R,5R,6R,8R)-2-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-5,11-dihydroxy-8-methyl-7,9-dioxatricyclo[6.2.1.01,6]undec-3-en-10-one.
| Compound Name | (1S,2R,5R,6R,8R)-2-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-5,11-dihydroxy-8-methyl-7,9-dioxatricyclo[6.2.1.01,6]undec-3-en-10-one |
|---|---|
| PubChem CID | 102025315 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (1S,2R,5R,6R,8R)-2-[(E,3R,5R)-3,5-dimethylhept-1-enyl]-5,11-dihydroxy-8-methyl-7,9-dioxatricyclo[6.2.1.01,6]undec-3-en-10-one |
| SMILES | CC[C@@H](C)C[C@@H](C)/C=C/[C@@H]1C=C[C@@H](O)[C@@H]2O[C@]3(C)OC(=O)[C@]12C3O |
| InChI | InChI=1S/C19H28O5/c1-5-11(2)10-12(3)6-7-13-8-9-14(20)15-19(13)16(21)18(4,23-15)24-17(19)22/h6-9,11-16,20-21H,5,10H2,1-4H3/b7-6+/t11-,12+,13-,14-,15+,16?,18-,19-/m1/s1 |
| InChIKey | KMJIBJZHUZVXRL-GIDIXUSBSA-N |
| XLogP | 2.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|