About ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate
ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate (PubChem CID 102025367) has the molecular formula C19H36O4Si
and a molecular weight of 356.58 g/mol. Its IUPAC name is ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate.
Molecular Properties
| Compound Name | ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate |
| PubChem CID | 102025367 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate |
| SMILES | CCOC(=O)CO[C@H]1C=C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C19H36O4Si/c1-8-21-19(20)13-22-18-10-9-17(11-18)12-23-24(14(2)3,15(4)5)16(6)7/h9-10,14-18H,8,11-13H2,1-7H3/t17-,18+/m1/s1 |
| InChIKey | MIRWPIRHTAFUBA-MSOLQXFVSA-N |
| XLogP | 4.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate?
The IUPAC name of ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate (CID 102025367) is ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate.
What is the SMILES notation for ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate?
The canonical SMILES for ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate is CCOC(=O)CO[C@H]1C=C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)C1.
What is the InChIKey of ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate?
The InChIKey is MIRWPIRHTAFUBA-MSOLQXFVSA-N. The full InChI is InChI=1S/C19H36O4Si/c1-8-21-19(20)13-22-18-10-9-17(11-18)12-23-24(14(2)3,15(4)5)16(6)7/h9-10,14-18H,8,11-13H2,1-7H3/t17-,18+/m1/s1.
What are the key properties of ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate?
ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate has a molecular weight of 356.58 g/mol, XLogP of 4.70, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1R,4S)-4-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-yl]oxyacetate is sourced from PubChem (CID 102025367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).