C16H26N2O2 — CID 102025416
4-[(1R,2R)-2-(4-oxopentan-2-ylideneamino)cyclohexyl]iminopentan-2-one (PubChem CID 102025416) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-[(1R,2R)-2-(4-oxopentan-2-ylideneamino)cyclohexyl]iminopentan-2-one.
| Compound Name | 4-[(1R,2R)-2-(4-oxopentan-2-ylideneamino)cyclohexyl]iminopentan-2-one |
|---|---|
| PubChem CID | 102025416 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 4-[(1R,2R)-2-(4-oxopentan-2-ylideneamino)cyclohexyl]iminopentan-2-one |
| SMILES | CC(=O)C/C(C)=N/[C@@H]1CCCC[C@H]1/N=C(\C)CC(C)=O |
| InChI | InChI=1S/C16H26N2O2/c1-11(9-13(3)19)17-15-7-5-6-8-16(15)18-12(2)10-14(4)20/h15-16H,5-10H2,1-4H3/b17-11+,18-12+/t15-,16-/m1/s1 |
| InChIKey | OIOGOZGHXVULNH-WLNUUSRZSA-N |
| XLogP | 3.18 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|