C9H6F3NO — CID 102025466
2-(2,4,6-trifluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 102025466) has the molecular formula C9H6F3NO and a molecular weight of 201.15 g/mol. Its IUPAC name is 2-(2,4,6-trifluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,4,6-trifluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102025466 |
| Molecular Formula | C9H6F3NO |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-(2,4,6-trifluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1cc(F)c(C2=NCCO2)c(F)c1 |
| InChI | InChI=1S/C9H6F3NO/c10-5-3-6(11)8(7(12)4-5)9-13-1-2-14-9/h3-4H,1-2H2 |
| InChIKey | WPGOMLOJRYPLCS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |