About 4-methoxy-1H-2,3-benzoxazine
4-methoxy-1H-2,3-benzoxazine (PubChem CID 102025489) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 4-methoxy-1H-2,3-benzoxazine.
Molecular Properties
| Compound Name | 4-methoxy-1H-2,3-benzoxazine |
| PubChem CID | 102025489 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 4-methoxy-1H-2,3-benzoxazine |
| SMILES | COC1=NOCc2ccccc21 |
| InChI | InChI=1S/C9H9NO2/c1-11-9-8-5-3-2-4-7(8)6-12-10-9/h2-5H,6H2,1H3 |
| InChIKey | NXPAWWNDLHFAHO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-1H-2,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1H-2,3-benzoxazine?
The IUPAC name of 4-methoxy-1H-2,3-benzoxazine (CID 102025489) is 4-methoxy-1H-2,3-benzoxazine.
What is the SMILES notation for 4-methoxy-1H-2,3-benzoxazine?
The canonical SMILES for 4-methoxy-1H-2,3-benzoxazine is COC1=NOCc2ccccc21.
What is the InChIKey of 4-methoxy-1H-2,3-benzoxazine?
The InChIKey is NXPAWWNDLHFAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-11-9-8-5-3-2-4-7(8)6-12-10-9/h2-5H,6H2,1H3.
What are the key properties of 4-methoxy-1H-2,3-benzoxazine?
4-methoxy-1H-2,3-benzoxazine has a molecular weight of 163.18 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1H-2,3-benzoxazine is sourced from PubChem (CID 102025489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).