C39H39N5O2 — CID 102025564
N-[4-[[3,5-diethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-(4-nitrophenyl)methyl]-2,6-diethylphenyl]-1-pyridin-2-ylmethanimine (PubChem CID 102025564) has the molecular formula C39H39N5O2 and a molecular weight of 609.77 g/mol. Its IUPAC name is N-[4-[[3,5-diethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-(4-nitrophenyl)methyl]-2,6-diethylphenyl]-1-pyridin-2-ylmethanimine.
| Compound Name | N-[4-[[3,5-diethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-(4-nitrophenyl)methyl]-2,6-diethylphenyl]-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 102025564 |
| Molecular Formula | C39H39N5O2 |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | N-[4-[[3,5-diethyl-4-(pyridin-2-ylmethylideneamino)phenyl]-(4-nitrophenyl)methyl]-2,6-diethylphenyl]-1-pyridin-2-ylmethanimine |
| SMILES | CCc1cc(C(c2ccc([N+](=O)[O-])cc2)c2cc(CC)c(/N=C/c3ccccn3)c(CC)c2)cc(CC)c1/N=C/c1ccccn1 |
| InChI | InChI=1S/C39H39N5O2/c1-5-27-21-32(22-28(6-2)38(27)42-25-34-13-9-11-19-40-34)37(31-15-17-36(18-16-31)44(45)46)33-23-29(7-3)39(30(8-4)24-33)43-26-35-14-10-12-20-41-35/h9-26,37H,5-8H2,1-4H3/b42-25+,43-26+ |
| InChIKey | CORFUZHWCIHSOE-DCRHPOARSA-N |
| XLogP | 9.32 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|