C25H42FNO3 — CID 10202557
4-[(3R,5R,6S)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(fluoromethyl)pentanamide (PubChem CID 10202557) has the molecular formula C25H42FNO3 and a molecular weight of 423.61 g/mol. Its IUPAC name is 4-[(3R,5R,6S)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(fluoromethyl)pentanamide.
| Compound Name | 4-[(3R,5R,6S)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(fluoromethyl)pentanamide |
|---|---|
| PubChem CID | 10202557 |
| Molecular Formula | C25H42FNO3 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | 4-[(3R,5R,6S)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(fluoromethyl)pentanamide |
| SMILES | CC(CCC(=O)NCF)C1CCC2C3C[C@H](O)[C@@H]4C[C@H](O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H42FNO3/c1-15(4-7-23(30)27-14-26)18-5-6-19-17-13-22(29)21-12-16(28)8-10-25(21,3)20(17)9-11-24(18,19)2/h15-22,28-29H,4-14H2,1-3H3,(H,27,30)/t15?,16-,17?,18?,19?,20?,21+,22+,24?,25?/m1/s1 |
| InChIKey | LWFJTEFNFHWRII-JFLLMRGQSA-N |
| XLogP | 4.44 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|