C25H20Cl2 — CID 102025715
2-[2,2-bis(4-chlorophenyl)ethenyl]-1,1-dimethylindene (PubChem CID 102025715) has the molecular formula C25H20Cl2 and a molecular weight of 391.34 g/mol. Its IUPAC name is 2-[2,2-bis(4-chlorophenyl)ethenyl]-1,1-dimethylindene.
| Compound Name | 2-[2,2-bis(4-chlorophenyl)ethenyl]-1,1-dimethylindene |
|---|---|
| PubChem CID | 102025715 |
| Molecular Formula | C25H20Cl2 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-[2,2-bis(4-chlorophenyl)ethenyl]-1,1-dimethylindene |
| SMILES | CC1(C)C(C=C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)=Cc2ccccc21 |
| InChI | InChI=1S/C25H20Cl2/c1-25(2)20(15-19-5-3-4-6-24(19)25)16-23(17-7-11-21(26)12-8-17)18-9-13-22(27)14-10-18/h3-16H,1-2H3 |
| InChIKey | BBAGCAZDIVLLKK-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |