About 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one
4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one (PubChem CID 102025745) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one.
Molecular Properties
| Compound Name | 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one |
| PubChem CID | 102025745 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one |
| SMILES | CCCC(=O)C1=C(CCC)OC(O)(CCC)C1=O |
| InChI | InChI=1S/C14H22O4/c1-4-7-10(15)12-11(8-5-2)18-14(17,9-6-3)13(12)16/h17H,4-9H2,1-3H3 |
| InChIKey | GUSJBGCVAXGTLF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one?
The IUPAC name of 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one (CID 102025745) is 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one.
What is the SMILES notation for 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one?
The canonical SMILES for 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one is CCCC(=O)C1=C(CCC)OC(O)(CCC)C1=O.
What is the InChIKey of 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one?
The InChIKey is GUSJBGCVAXGTLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-4-7-10(15)12-11(8-5-2)18-14(17,9-6-3)13(12)16/h17H,4-9H2,1-3H3.
What are the key properties of 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one?
4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one has a molecular weight of 254.33 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butanoyl-2-hydroxy-2,5-dipropylfuran-3-one is sourced from PubChem (CID 102025745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).