C41H47F3O5S5 — CID 102025801
(5,11,17,23-tetratert-butyl-26,27-dihydroxy-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaen-25-yl) trifluoromethanesulfonate (PubChem CID 102025801) has the molecular formula C41H47F3O5S5 and a molecular weight of 837.15 g/mol. Its IUPAC name is (5,11,17,23-tetratert-butyl-26,27-dihydroxy-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaen-25-yl) trifluoromethanesulfonate.
| Compound Name | (5,11,17,23-tetratert-butyl-26,27-dihydroxy-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaen-25-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102025801 |
| Molecular Formula | C41H47F3O5S5 |
| Molecular Weight | 837.15 g/mol |
| Exact Mass | 836.20 |
| IUPAC Name | (5,11,17,23-tetratert-butyl-26,27-dihydroxy-2,8,14,20-tetrathiapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaen-25-yl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc2cc(c1)Sc1cc(C(C)(C)C)cc(c1OS(=O)(=O)C(F)(F)F)Sc1cc(C(C)(C)C)cc(c1O)Sc1cc(C(C)(C)C)cc(c1O)S2 |
| InChI | InChI=1S/C41H47F3O5S5/c1-37(2,3)22-13-26-21-27(14-22)51-32-19-25(40(10,11)12)20-33(36(32)49-54(47,48)41(42,43)44)53-31-18-24(39(7,8)9)17-30(35(31)46)52-29-16-23(38(4,5)6)15-28(50-26)34(29)45/h13-21,45-46H,1-12H3 |
| InChIKey | BMHKGVSOSCEJPT-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.15 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|