About N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide
N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide (PubChem CID 102026166) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide |
| PubChem CID | 102026166 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide |
| SMILES | CC(=O)NCCNC(=O)C1C=CC=C1 |
| InChI | InChI=1S/C10H14N2O2/c1-8(13)11-6-7-12-10(14)9-4-2-3-5-9/h2-5,9H,6-7H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | JCTDIJLFPAZTGP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide?
The IUPAC name of N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide (CID 102026166) is N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide.
What is the SMILES notation for N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide?
The canonical SMILES for N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide is CC(=O)NCCNC(=O)C1C=CC=C1.
What is the InChIKey of N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide?
The InChIKey is JCTDIJLFPAZTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-8(13)11-6-7-12-10(14)9-4-2-3-5-9/h2-5,9H,6-7H2,1H3,(H,11,13)(H,12,14).
What are the key properties of N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide?
N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide has a molecular weight of 194.23 g/mol, XLogP of -0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-acetamidoethyl)cyclopenta-2,4-diene-1-carboxamide is sourced from PubChem (CID 102026166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).