C28H33NOSi — CID 102026757
[diphenyl-[(2S)-1-[(E)-2-phenylethenyl]pyrrolidin-2-yl]methoxy]-trimethylsilane (PubChem CID 102026757) has the molecular formula C28H33NOSi and a molecular weight of 427.66 g/mol. Its IUPAC name is [diphenyl-[(2S)-1-[(E)-2-phenylethenyl]pyrrolidin-2-yl]methoxy]-trimethylsilane.
| Compound Name | [diphenyl-[(2S)-1-[(E)-2-phenylethenyl]pyrrolidin-2-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 102026757 |
| Molecular Formula | C28H33NOSi |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [diphenyl-[(2S)-1-[(E)-2-phenylethenyl]pyrrolidin-2-yl]methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1/C=C/c1ccccc1 |
| InChI | InChI=1S/C28H33NOSi/c1-31(2,3)30-28(25-16-9-5-10-17-25,26-18-11-6-12-19-26)27-20-13-22-29(27)23-21-24-14-7-4-8-15-24/h4-12,14-19,21,23,27H,13,20,22H2,1-3H3/b23-21+/t27-/m0/s1 |
| InChIKey | QVIYFJJADMNJOQ-NDLSKRMFSA-N |
| XLogP | 6.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|