About 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea
1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 10202686) has the molecular formula C20H22Cl2FN3O2
and a molecular weight of 426.32 g/mol. Its IUPAC name is 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea.
Molecular Properties
| Compound Name | 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea |
| PubChem CID | 10202686 |
| Molecular Formula | C20H22Cl2FN3O2 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(F)cc1)NCC1CN(Cc2ccc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C20H22Cl2FN3O2/c21-18-6-3-15(9-19(18)22)12-26-7-8-28-17(13-26)11-25-20(27)24-10-14-1-4-16(23)5-2-14/h1-6,9,17H,7-8,10-13H2,(H2,24,25,27) |
| InChIKey | WSBJFOIHSAQYAZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea?
The IUPAC name of 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea (CID 10202686) is 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea.
What is the SMILES notation for 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea?
The canonical SMILES for 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea is O=C(NCc1ccc(F)cc1)NCC1CN(Cc2ccc(Cl)c(Cl)c2)CCO1.
What is the InChIKey of 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea?
The InChIKey is WSBJFOIHSAQYAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2FN3O2/c21-18-6-3-15(9-19(18)22)12-26-7-8-28-17(13-26)11-25-20(27)24-10-14-1-4-16(23)5-2-14/h1-6,9,17H,7-8,10-13H2,(H2,24,25,27).
What are the key properties of 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea?
1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea has a molecular weight of 426.32 g/mol, XLogP of 3.83, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methyl]-3-[(4-fluorophenyl)methyl]urea is sourced from PubChem (CID 10202686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).